Difference between revisions of "SJ19583"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COPROPORPHYRIN_III COPROPORPHYRIN_III] == * common-name: ** coproporphyrin iii * smiles: ** cc1...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Pre-tRNA-3-prime-half-molecules Pre-tRNA-3-prime-half-molecules] == * common-name: ** a 3'-half...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COPROPORPHYRIN_III COPROPORPHYRIN_III] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Pre-tRNA-3-prime-half-molecules Pre-tRNA-3-prime-half-molecules] ==
 
* common-name:
 
* common-name:
** coproporphyrin iii
+
** a 3'-half-trna molecule with a 5'-oh end
* smiles:
 
** cc1(=c2(c=c5(c(c)=c(ccc([o-])=o)c(c=c4(c(ccc([o-])=o)=c(c)c(=cc3(c(ccc(=o)[o-])=c(c)c(=cc(=c(ccc([o-])=o)1)n2)n=3))n4))=n5)))
 
* inchi-key:
 
** jwfcywsmnrlxlx-ujjxfscmsa-j
 
* molecular-weight:
 
** 650.687
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17518]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17517]]
+
* [[3.1.27.9-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=coproporphyrin iii}}
+
{{#set: common-name=a 3'-half-trna molecule with a 5'-oh end}}
{{#set: inchi-key=inchikey=jwfcywsmnrlxlx-ujjxfscmsa-j}}
 
{{#set: molecular-weight=650.687}}
 

Revision as of 09:24, 27 August 2019

Metabolite Pre-tRNA-3-prime-half-molecules

  • common-name:
    • a 3'-half-trna molecule with a 5'-oh end

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality