Difference between revisions of "SJ06876"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14154 CPD-14154] == * common-name: ** tobramycin * smiles: ** c([n+])c1(c(cc(c(o1)oc2(c(c(c...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6262 CPD-6262] == * common-name: ** a [cys-gly]-s-conjugate == Reaction(s) known to consume...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14154 CPD-14154] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6262 CPD-6262] ==
 
* common-name:
 
* common-name:
** tobramycin
+
** a [cys-gly]-s-conjugate
* smiles:
 
** c([n+])c1(c(cc(c(o1)oc2(c(c(c([n+])cc([n+])2)oc3(oc(c(c(c(o)3)[n+])o)co))o))[n+])o)
 
* inchi-key:
 
** nlvfbuxfdbbnbw-pbsuhmdjsa-s
 
* molecular-weight:
 
** 472.558
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13168]]
+
* [[RXN-6642]]
* [[RXN-15284]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-6641]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=tobramycin}}
+
{{#set: common-name=a [cys-gly]-s-conjugate}}
{{#set: inchi-key=inchikey=nlvfbuxfdbbnbw-pbsuhmdjsa-s}}
 
{{#set: molecular-weight=472.558}}
 

Revision as of 09:24, 27 August 2019

Metabolite CPD-6262

  • common-name:
    • a [cys-gly]-s-conjugate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [cys-gly]-s-conjugate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.