Difference between revisions of "SJ22353"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPROSTADIL ALPROSTADIL] == * common-name: ** (13e)-(15s)-11-α,15-dihydroxy-9-oxoprost-13...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MEVALONATE MEVALONATE] == * common-name: ** (r)-mevalonate * smiles: ** cc(o)(cco)cc(=o)[o-] *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPROSTADIL ALPROSTADIL] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MEVALONATE MEVALONATE] ==
 
* common-name:
 
* common-name:
** (13e)-(15s)-11-α,15-dihydroxy-9-oxoprost-13-enoate
+
** (r)-mevalonate
 
* smiles:
 
* smiles:
** cccccc(o)c=cc1(c(o)cc(=o)c(ccccccc(=o)[o-])1)
+
** cc(o)(cco)cc(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** gmvprgqoioiimi-dwkjamrdsa-m
+
** kjtlqquupvsxim-zcfiwibfsa-m
 
* molecular-weight:
 
* molecular-weight:
** 353.478
+
** 147.15
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.1.1.197-RXN]]
+
* [[1.1.1.34-RXN]]
 +
* [[MEVALONATE-KINASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.1.1.197-RXN]]
+
* [[1.1.1.34-RXN]]
 +
* [[MEVALONATE-KINASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(13e)-(15s)-11-α,15-dihydroxy-9-oxoprost-13-enoate}}
+
{{#set: common-name=(r)-mevalonate}}
{{#set: inchi-key=inchikey=gmvprgqoioiimi-dwkjamrdsa-m}}
+
{{#set: inchi-key=inchikey=kjtlqquupvsxim-zcfiwibfsa-m}}
{{#set: molecular-weight=353.478}}
+
{{#set: molecular-weight=147.15}}

Revision as of 09:24, 27 August 2019

Metabolite MEVALONATE

  • common-name:
    • (r)-mevalonate
  • smiles:
    • cc(o)(cco)cc(=o)[o-]
  • inchi-key:
    • kjtlqquupvsxim-zcfiwibfsa-m
  • molecular-weight:
    • 147.15

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality