Difference between revisions of "SJ04593"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9459 CPD-9459] == * common-name: ** oleanolate * smiles: ** cc3(c[ch]4(c2(=cc[ch]5(c1(ccc(c...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7496 CPD-7496] == * common-name: ** prolycopene * smiles: ** cc(=cccc(=cc=cc(c)=cc=cc(=cc=c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7496 CPD-7496] == |
* common-name: | * common-name: | ||
| − | ** | + | ** prolycopene |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(=cccc(=cc=cc(c)=cc=cc(=cc=cc=c(c=cc=c(c)c=cc=c(ccc=c(c)c)c)c)c)c)c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** oaijszizwzsqbc-byunhuqqsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 536.882 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-8042]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-11357]] | ||
| + | * [[RXN-12242]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=prolycopene}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=oaijszizwzsqbc-byunhuqqsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=536.882}} |
Revision as of 09:24, 27 August 2019
Contents
Metabolite CPD-7496
- common-name:
- prolycopene
- smiles:
- cc(=cccc(=cc=cc(c)=cc=cc(=cc=cc=c(c=cc=c(c)c=cc=c(ccc=c(c)c)c)c)c)c)c
- inchi-key:
- oaijszizwzsqbc-byunhuqqsa-n
- molecular-weight:
- 536.882
