Difference between revisions of "SJ14681"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7117 CPD-7117] == * common-name: ** delphinidin-3-o-β-d-glucoside * smiles: ** c(o)c1(...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLY-tRNAs GLY-tRNAs] == * common-name: ** a trnagly == Reaction(s) known to consume the compoun...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7117 CPD-7117] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLY-tRNAs GLY-tRNAs] ==
 
* common-name:
 
* common-name:
** delphinidin-3-o-β-d-glucoside
+
** a trnagly
* smiles:
 
** c(o)c1(c(o)c(o)c(o)c(o1)oc3(c(c2(c=c(o)c(o)=c(o)c=2))=[o+]c4(c(c=3)=c([o-])c=c([o-])c=4)))
 
* inchi-key:
 
** xenhpqqldpayij-pevlunpasa-m
 
* molecular-weight:
 
** 463.374
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8228]]
+
* [[GLYCINE--TRNA-LIGASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=delphinidin-3-o-β-d-glucoside}}
+
{{#set: common-name=a trnagly}}
{{#set: inchi-key=inchikey=xenhpqqldpayij-pevlunpasa-m}}
 
{{#set: molecular-weight=463.374}}
 

Revision as of 09:24, 27 August 2019

Metabolite GLY-tRNAs

  • common-name:
    • a trnagly

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality