Difference between revisions of "SJ06937"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MEVALONATE MEVALONATE] == * common-name: ** (r)-mevalonate * smiles: ** cc(o)(cco)cc(=o)[o-] *...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11403 CPD-11403] == * common-name: ** tetraiodothyroacetate * smiles: ** c(=o)([o-])cc1(c=c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11403 CPD-11403] == |
* common-name: | * common-name: | ||
| − | ** | + | ** tetraiodothyroacetate |
* smiles: | * smiles: | ||
| − | ** | + | ** c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc2(=cc(i)=c(o)c(i)=c2)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ppjyssnksxavdb-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 746.825 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-10616]] |
| − | * [[ | + | * [[RXN-10617]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=tetraiodothyroacetate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ppjyssnksxavdb-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=746.825}} |
Revision as of 09:24, 27 August 2019
Contents
Metabolite CPD-11403
- common-name:
- tetraiodothyroacetate
- smiles:
- c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc2(=cc(i)=c(o)c(i)=c2))
- inchi-key:
- ppjyssnksxavdb-uhfffaoysa-m
- molecular-weight:
- 746.825
