Difference between revisions of "SJ00687"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-SULFINOALANINE 3-SULFINOALANINE] == * common-name: ** 3-sulfinoalanine * smiles: ** c(c([n+])...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12130 CPD-12130] == * common-name: ** menaquinol-13 * smiles: ** cc(=cccc(=cccc(=cccc(=cccc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-SULFINOALANINE 3-SULFINOALANINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12130 CPD-12130] ==
 
* common-name:
 
* common-name:
** 3-sulfinoalanine
+
** menaquinol-13
 
* smiles:
 
* smiles:
** c(c([n+])c(=o)[o-])s([o-])=o
+
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c)=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c)c)c)c
 
* inchi-key:
 
* inchi-key:
** advptqaunprnpo-reohclbhsa-m
+
** zlhyydgaqjjtjl-hwrcdasfsa-n
 
* molecular-weight:
 
* molecular-weight:
** 152.145
+
** 1059.735
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3-SULFINOALANINE-AMINOTRANSFERASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3-SULFINOALANINE-AMINOTRANSFERASE-RXN]]
+
* [[RXN-9366]]
* [[CYSTEINE-DIOXYGENASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-sulfinoalanine}}
+
{{#set: common-name=menaquinol-13}}
{{#set: inchi-key=inchikey=advptqaunprnpo-reohclbhsa-m}}
+
{{#set: inchi-key=inchikey=zlhyydgaqjjtjl-hwrcdasfsa-n}}
{{#set: molecular-weight=152.145}}
+
{{#set: molecular-weight=1059.735}}

Revision as of 09:24, 27 August 2019

Metabolite CPD-12130

  • common-name:
    • menaquinol-13
  • smiles:
    • cc(=cccc(=cccc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c)=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c)c)c)c
  • inchi-key:
    • zlhyydgaqjjtjl-hwrcdasfsa-n
  • molecular-weight:
    • 1059.735

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality