Difference between revisions of "SJ15771"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CARBON-MONOXIDE CARBON-MONOXIDE] == * common-name: ** carbon monoxide * smiles: ** [c-]#[o+] *...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11402 CPD-11402] == * common-name: ** 3,5,3'-triiodo-l-thyronine acyl β-d-glucuronide...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CARBON-MONOXIDE CARBON-MONOXIDE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11402 CPD-11402] ==
 
* common-name:
 
* common-name:
** carbon monoxide
+
** 3,5,3'-triiodo-l-thyronine acyl β-d-glucuronide
 
* smiles:
 
* smiles:
** [c-]#[o+]
+
** c([o-])(=o)c1(oc(c(o)c(o)c(o)1)oc(=o)c(n)cc2(=cc(i)=c(c(i)=c2)oc3(=cc(i)=c(o)c=c3)))
 
* inchi-key:
 
* inchi-key:
** ugfairiumavxcw-uhfffaoysa-n
+
** lqmbvwcqwfepfk-dkbymcrtsa-m
 
* molecular-weight:
 
* molecular-weight:
** 28.01
+
** 826.095
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[HEME-OXYGENASE-DECYCLIZING-RXN]]
+
* [[RXN-10609]]
* [[PYRIMSYN1-RXN]]
 
* [[QUERCETIN-23-DIOXYGENASE-RXN]]
 
* [[RXN-17523]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=carbon monoxide}}
+
{{#set: common-name=3,5,3'-triiodo-l-thyronine acyl β-d-glucuronide}}
{{#set: inchi-key=inchikey=ugfairiumavxcw-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=lqmbvwcqwfepfk-dkbymcrtsa-m}}
{{#set: molecular-weight=28.01}}
+
{{#set: molecular-weight=826.095}}

Revision as of 09:24, 27 August 2019

Metabolite CPD-11402

  • common-name:
    • 3,5,3'-triiodo-l-thyronine acyl β-d-glucuronide
  • smiles:
    • c([o-])(=o)c1(oc(c(o)c(o)c(o)1)oc(=o)c(n)cc2(=cc(i)=c(c(i)=c2)oc3(=cc(i)=c(o)c=c3)))
  • inchi-key:
    • lqmbvwcqwfepfk-dkbymcrtsa-m
  • molecular-weight:
    • 826.095

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality