Difference between revisions of "SJ09340"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-CYTIDINE-5-DIPHOSPHO-2-C 4-CYTIDINE-5-DIPHOSPHO-2-C] == * common-name: ** 4-(cytidine 5'-diph...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Aldoses Aldoses] == * common-name: ** an aldose == Reaction(s) known to consume the compound ==...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-CYTIDINE-5-DIPHOSPHO-2-C 4-CYTIDINE-5-DIPHOSPHO-2-C] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Aldoses Aldoses] ==
 
* common-name:
 
* common-name:
** 4-(cytidine 5'-diphospho)-2-c-methyl-d-erythritol
+
** an aldose
* smiles:
 
** cc(o)(co)c(o)cop(op([o-])(=o)occ2(c(c(o)c(n1(c(n=c(c=c1)n)=o))o2)o))([o-])=o
 
* inchi-key:
 
** yfaukwznpvbcff-xhibxcghsa-l
 
* molecular-weight:
 
** 519.295
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.7.1.148-RXN]]
+
* [[ALDEHYDE-REDUCTASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.7.7.60-RXN]]
+
* [[ALDEHYDE-REDUCTASE-RXN]]
 +
* [[RXN-9926]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-(cytidine 5'-diphospho)-2-c-methyl-d-erythritol}}
+
{{#set: common-name=an aldose}}
{{#set: inchi-key=inchikey=yfaukwznpvbcff-xhibxcghsa-l}}
 
{{#set: molecular-weight=519.295}}
 

Revision as of 09:24, 27 August 2019

Metabolite Aldoses

  • common-name:
    • an aldose

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality