Difference between revisions of "SJ14430"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NIACINAMIDE NIACINAMIDE] == * common-name: ** nicotinamide * smiles: ** c1(n=cc(c(=o)n)=cc=1) *...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7733 CPD-7733] == * common-name: ** aurachin c * smiles: ** cc(c)=cccc(c)=cccc(c)=ccc2(c(c1...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7733 CPD-7733] == |
* common-name: | * common-name: | ||
| − | ** | + | ** aurachin c |
* smiles: | * smiles: | ||
| − | ** c1( | + | ** cc(c)=cccc(c)=cccc(c)=ccc2(c(c1(c=cc=cc=1n(c(c)=2)o))=o) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** fihxchbehlcxeg-yefhwucqsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 379.541 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-15029]] |
| − | * [[ | + | * [[RXN-17335]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=aurachin c}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=fihxchbehlcxeg-yefhwucqsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=379.541}} |
Revision as of 09:24, 27 August 2019
Contents
Metabolite CPD-7733
- common-name:
- aurachin c
- smiles:
- cc(c)=cccc(c)=cccc(c)=ccc2(c(c1(c=cc=cc=1n(c(c)=2)o))=o)
- inchi-key:
- fihxchbehlcxeg-yefhwucqsa-n
- molecular-weight:
- 379.541
