Difference between revisions of "SJ11512"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15652 CPD-15652] == * common-name: ** (3r)-hydroxy, 6-trans-tridecenoyl-coa * smiles: ** cc...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HYDRPHENYLAC-CPD HYDRPHENYLAC-CPD] == * common-name: ** (4-hydroxyphenyl)acetaldehyde * smiles:...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15652 CPD-15652] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HYDRPHENYLAC-CPD HYDRPHENYLAC-CPD] ==
 
* common-name:
 
* common-name:
** (3r)-hydroxy, 6-trans-tridecenoyl-coa
+
** (4-hydroxyphenyl)acetaldehyde
 
* smiles:
 
* smiles:
** ccccccc=cccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** [ch](=o)cc1(c=cc(o)=cc=1)
 
* inchi-key:
 
* inchi-key:
** adzjvtnixnsngu-ovqifrbasa-j
+
** iprppfiavhpvjh-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 973.818
+
** 136.15
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN3O-4113]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14786]]
+
* [[RXN-5821]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(3r)-hydroxy, 6-trans-tridecenoyl-coa}}
+
{{#set: common-name=(4-hydroxyphenyl)acetaldehyde}}
{{#set: inchi-key=inchikey=adzjvtnixnsngu-ovqifrbasa-j}}
+
{{#set: inchi-key=inchikey=iprppfiavhpvjh-uhfffaoysa-n}}
{{#set: molecular-weight=973.818}}
+
{{#set: molecular-weight=136.15}}

Revision as of 09:24, 27 August 2019

Metabolite HYDRPHENYLAC-CPD

  • common-name:
    • (4-hydroxyphenyl)acetaldehyde
  • smiles:
    • [ch](=o)cc1(c=cc(o)=cc=1)
  • inchi-key:
    • iprppfiavhpvjh-uhfffaoysa-n
  • molecular-weight:
    • 136.15

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality