Difference between revisions of "SJ05965"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11975 CPD-11975] == * common-name: ** 1-o-(2-acetamido-2-deoxy-α-d-glucopyranosyl)-1d...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1422 CPD0-1422] == * common-name: ** dipalmitoyl phosphatidate * smiles: ** cccccccccccccc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11975 CPD-11975] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1422 CPD0-1422] ==
 
* common-name:
 
* common-name:
** 1-o-(2-acetamido-2-deoxy-α-d-glucopyranosyl)-1d-myo-inositol 3-phosphate
+
** dipalmitoyl phosphatidate
 
* smiles:
 
* smiles:
** cc(=o)nc2(c(oc1(c(o)c(o)c(o)c(op([o-])(=o)[o-])c(o)1))oc(c(c2o)o)co)
+
** cccccccccccccccc(=o)occ(cop(=o)([o-])[o-])oc(ccccccccccccccc)=o
 
* inchi-key:
 
* inchi-key:
** chttvmdqgbocme-dnswdbfxsa-l
+
** porpenfltbbhsg-mgbgtmovsa-l
 
* molecular-weight:
 
* molecular-weight:
** 461.316
+
** 646.883
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[PHOSPHATIDATE-PHOSPHATASE-RXN-CPD0-1422/WATER//CPD66-34/Pi.29.]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-6501]]
+
* [[RXN0-6705]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-o-(2-acetamido-2-deoxy-α-d-glucopyranosyl)-1d-myo-inositol 3-phosphate}}
+
{{#set: common-name=dipalmitoyl phosphatidate}}
{{#set: inchi-key=inchikey=chttvmdqgbocme-dnswdbfxsa-l}}
+
{{#set: inchi-key=inchikey=porpenfltbbhsg-mgbgtmovsa-l}}
{{#set: molecular-weight=461.316}}
+
{{#set: molecular-weight=646.883}}

Revision as of 09:24, 27 August 2019

Metabolite CPD0-1422

  • common-name:
    • dipalmitoyl phosphatidate
  • smiles:
    • cccccccccccccccc(=o)occ(cop(=o)([o-])[o-])oc(ccccccccccccccc)=o
  • inchi-key:
    • porpenfltbbhsg-mgbgtmovsa-l
  • molecular-weight:
    • 646.883

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality