Difference between revisions of "SJ07124"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-676 CPD-676] == * common-name: ** trans-caffeate * smiles: ** c([o-])(=o)c=cc1(c=c(o)c(o)=c...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17539 CPD-17539] == * common-name: ** dapdiamide a * smiles: ** cc(c)c(c([o-])=o)nc(c(cnc(=...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17539 CPD-17539] == |
* common-name: | * common-name: | ||
| − | ** | + | ** dapdiamide a |
* smiles: | * smiles: | ||
| − | ** c([o-]) | + | ** cc(c)c(c([o-])=o)nc(c(cnc(=o)c=cc(n)=o)[n+])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** jagleobxishnnm-bruqvklwsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 300.314 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-16291]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=dapdiamide a}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=jagleobxishnnm-bruqvklwsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=300.314}} |
Revision as of 09:24, 27 August 2019
Contents
Metabolite CPD-17539
- common-name:
- dapdiamide a
- smiles:
- cc(c)c(c([o-])=o)nc(c(cnc(=o)c=cc(n)=o)[n+])=o
- inchi-key:
- jagleobxishnnm-bruqvklwsa-n
- molecular-weight:
- 300.314
