Difference between revisions of "SJ00174"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-GLUCURONATE UDP-GLUCURONATE] == * common-name: ** udp-α-d-glucuronate * smiles: ** c(...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4162 CPD-4162] == * common-name: ** stigmasterol * smiles: ** ccc(c(c)c)c=cc(c)[ch]3(cc[ch]...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-GLUCURONATE UDP-GLUCURONATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4162 CPD-4162] ==
 
* common-name:
 
* common-name:
** udp-α-d-glucuronate
+
** stigmasterol
 
* smiles:
 
* smiles:
** c(c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))op(=o)([o-])op(=o)([o-])oc3(oc(c([o-])=o)c(o)c(o)c(o)3)
+
** ccc(c(c)c)c=cc(c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34))))
 
* inchi-key:
 
* inchi-key:
** hdyanyhvcapmjv-lxqifkjmsa-k
+
** hcxvjbmsmiarin-phzdydngsa-n
 
* molecular-weight:
 
* molecular-weight:
** 577.265
+
** 412.698
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[RXN-12126]]
* [[2.4.1.212-RXN]]
 
* [[2.4.1.225-RXN]]
 
* [[2.7.7.44-RXN]]
 
* [[RXN-10606]]
 
* [[RXN-10607]]
 
* [[RXN-10608]]
 
* [[RXN-10609]]
 
* [[RXN-10616]]
 
* [[RXN-10617]]
 
* [[RXN-10618]]
 
* [[RXN-10619]]
 
* [[RXN-10784]]
 
* [[RXN-11060]]
 
* [[RXN-13607]]
 
* [[RXN-13608]]
 
* [[RXN-14361]]
 
* [[RXN-9000]]
 
* [[RXN66-162]]
 
* [[RXN66-168]]
 
* [[RXN66-83]]
 
* [[UDP-GLUCURONATE-4-EPIMERASE-RXN]]
 
* [[UDP-GLUCURONATE-DECARBOXYLASE-RXN]]
 
* [[UDP-GLUCURONOSYLTRANSFERASE-RXN]]
 
* [[UGDC]]
 
</div>
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.7.7.44-RXN]]
 
* [[UDP-GLUCURONATE-4-EPIMERASE-RXN]]
 
* [[UGD-RXN]]
 
* [[UGDH]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=udp-&alpha;-d-glucuronate}}
+
{{#set: common-name=stigmasterol}}
{{#set: inchi-key=inchikey=hdyanyhvcapmjv-lxqifkjmsa-k}}
+
{{#set: inchi-key=inchikey=hcxvjbmsmiarin-phzdydngsa-n}}
{{#set: molecular-weight=577.265}}
+
{{#set: molecular-weight=412.698}}

Revision as of 09:24, 27 August 2019

Metabolite CPD-4162

  • common-name:
    • stigmasterol
  • smiles:
    • ccc(c(c)c)c=cc(c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34))))
  • inchi-key:
    • hcxvjbmsmiarin-phzdydngsa-n
  • molecular-weight:
    • 412.698

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality