Difference between revisions of "SJ05317"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-609 CPD-609] == * common-name: ** p1,p4-bis(5'-guanosyl) tetraphosphate * smiles: ** c(op(=...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-Cysteine-Desulfurase-persulfide L-Cysteine-Desulfurase-persulfide] == * common-name: ** an [l...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-609 CPD-609] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-Cysteine-Desulfurase-persulfide L-Cysteine-Desulfurase-persulfide] ==
 
* common-name:
 
* common-name:
** p1,p4-bis(5'-guanosyl) tetraphosphate
+
** an [l-cysteine desulfurase]-s-sulfanyl-l-cysteine
* smiles:
 
** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))))c4(oc(c(o)c(o)4)n6(c=nc5(c(=o)nc(n)=nc=56)))
 
* inchi-key:
 
** olgwxcqxrssqpo-mharetsrsa-j
 
* molecular-weight:
 
** 864.359
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.6.1.17-RXN]]
+
* [[RXN-12473]]
 +
* [[RXN-12587]]
 +
* [[RXN-14382]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-12587]]
 +
* [[RXN0-308]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=p1,p4-bis(5'-guanosyl) tetraphosphate}}
+
{{#set: common-name=an [l-cysteine desulfurase]-s-sulfanyl-l-cysteine}}
{{#set: inchi-key=inchikey=olgwxcqxrssqpo-mharetsrsa-j}}
 
{{#set: molecular-weight=864.359}}
 

Revision as of 09:24, 27 August 2019

Metabolite L-Cysteine-Desulfurase-persulfide

  • common-name:
    • an [l-cysteine desulfurase]-s-sulfanyl-l-cysteine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an [l-cysteine desulfurase]-s-sulfanyl-l-cysteine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.