Difference between revisions of "SJ14186"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-CYSTATHIONINE L-CYSTATHIONINE] == * common-name: ** l-cystathionine * smiles: ** c(scc(c([o-]...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10244 CPD-10244] == * common-name: ** docosahexaenoate * smiles: ** ccc=ccc=ccc=ccc=ccc=ccc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10244 CPD-10244] == |
* common-name: | * common-name: | ||
| − | ** | + | ** docosahexaenoate |
* smiles: | * smiles: | ||
| − | ** | + | ** ccc=ccc=ccc=ccc=ccc=ccc=cccc(=o)[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** mbmbgcfofbjsgt-kubavdmbsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 327.486 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN-16063]] | |
| − | |||
| − | |||
| − | |||
| − | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-16017]] |
| − | * [[ | + | * [[RXN-16063]] |
| − | * [[ | + | * [[RXN-16138]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=docosahexaenoate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=mbmbgcfofbjsgt-kubavdmbsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=327.486}} |
Revision as of 09:24, 27 August 2019
Contents
Metabolite CPD-10244
- common-name:
- docosahexaenoate
- smiles:
- ccc=ccc=ccc=ccc=ccc=ccc=cccc(=o)[o-]
- inchi-key:
- mbmbgcfofbjsgt-kubavdmbsa-m
- molecular-weight:
- 327.486
