Difference between revisions of "SJ03058"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACETYL-P ACETYL-P] == * common-name: ** acetyl phosphate * smiles: ** cc(op([o-])(=o)[o-])=o *...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CONIFERYL-ALCOHOL CONIFERYL-ALCOHOL] == * common-name: ** coniferyl alcohol * smiles: ** coc1(=...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CONIFERYL-ALCOHOL CONIFERYL-ALCOHOL] == |
* common-name: | * common-name: | ||
| − | ** | + | ** coniferyl alcohol |
* smiles: | * smiles: | ||
| − | ** cc( | + | ** coc1(=cc(c=cco)=cc=c(o)1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** jmfrwrfflbvwsi-nscuhmnnsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 180.203 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-17351]] |
| − | * [[ | + | * [[RXN-17352]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=coniferyl alcohol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=jmfrwrfflbvwsi-nscuhmnnsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=180.203}} |
Revision as of 09:24, 27 August 2019
Contents
Metabolite CONIFERYL-ALCOHOL
- common-name:
- coniferyl alcohol
- smiles:
- coc1(=cc(c=cco)=cc=c(o)1)
- inchi-key:
- jmfrwrfflbvwsi-nscuhmnnsa-n
- molecular-weight:
- 180.203
