Difference between revisions of "SJ20743"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PALMITATE PALMITATE] == * common-name: ** palmitate * smiles: ** cccccccccccccccc([o-])=o * inc...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14407 CPD-14407] == * common-name: ** dihomo γ-linolenoyl-coa * smiles: ** cccccc=ccc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PALMITATE PALMITATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14407 CPD-14407] ==
 
* common-name:
 
* common-name:
** palmitate
+
** dihomo γ-linolenoyl-coa
 
* smiles:
 
* smiles:
** cccccccccccccccc([o-])=o
+
** cccccc=ccc=ccc=cccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** ipcsvzssvzvige-uhfffaoysa-m
+
** fjwjalrunnzibb-ddquopdjsa-j
 
* molecular-weight:
 
* molecular-weight:
** 255.42
+
** 1051.975
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[FATTY-ACID-PEROXIDASE-RXN]]
+
* [[RXN-13435]]
* [[RXN-9623]]
+
* [[RXN-16044]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.1.1.64-RXN]]
+
* [[RXN-12971]]
* [[3.1.2.22-RXN]]
+
* [[RXN-17105]]
* [[PALMITOYL-COA-HYDROLASE-RXN]]
 
* [[RETINYL-PALMITATE-ESTERASE-RXN]]
 
* [[RXN-12430]]
 
* [[RXN-15065]]
 
* [[RXN-16655]]
 
* [[RXN-7952-CPD66-43/WATER//GLYCEROL/PALMITATE/PROTON.42.]]
 
* [[RXN-9549]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=palmitate}}
+
{{#set: common-name=dihomo γ-linolenoyl-coa}}
{{#set: inchi-key=inchikey=ipcsvzssvzvige-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=fjwjalrunnzibb-ddquopdjsa-j}}
{{#set: molecular-weight=255.42}}
+
{{#set: molecular-weight=1051.975}}

Revision as of 09:25, 27 August 2019

Metabolite CPD-14407

  • common-name:
    • dihomo γ-linolenoyl-coa
  • smiles:
    • cccccc=ccc=ccc=cccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • fjwjalrunnzibb-ddquopdjsa-j
  • molecular-weight:
    • 1051.975

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality