Difference between revisions of "SJ22060"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HIS HIS] == * common-name: ** l-histidine * smiles: ** c1(nc=nc=1cc(c(=o)[o-])[n+]) * inchi-key...") |
(Created page with "Category:gene == Gene SJ21701 == * transcription-direction: ** positive * right-end-position: ** 1008890 * left-end-position: ** 957947 * centisome-position: ** 84.68362...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:gene]] |
− | == | + | == Gene SJ21701 == |
− | * | + | * transcription-direction: |
− | ** | + | ** positive |
− | * | + | * right-end-position: |
− | ** | + | ** 1008890 |
− | * | + | * left-end-position: |
− | ** | + | ** 957947 |
− | * | + | * centisome-position: |
− | ** | + | ** 84.68362 |
− | == Reaction(s) | + | == Organism(s) associated with this gene == |
− | * [[ | + | * [[S.japonica_carotenoid_curated]] |
− | * [[ | + | == Reaction(s) associated == |
− | * [[ | + | * [[2OXOGLUTDECARB-RXN]] |
− | * [[ | + | ** Category: [[annotation]] |
− | + | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
− | * [[ | + | ** Category: [[orthology]] |
− | * [[ | + | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a |
− | * [[ | + | * [[AKGDHmi]] |
− | == | + | ** Category: [[orthology]] |
− | {{#set: | + | *** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a |
− | {{#set: | + | == Pathway(s) associated == |
− | {{#set: | + | * [[PWY66-398]] |
+ | ** '''10''' reactions found over '''11''' reactions in the full pathway | ||
+ | * [[PWY-5084]] | ||
+ | ** '''3''' reactions found over '''3''' reactions in the full pathway | ||
+ | {{#set: transcription-direction=positive}} | ||
+ | {{#set: right-end-position=1008890}} | ||
+ | {{#set: left-end-position=957947}} | ||
+ | {{#set: centisome-position=84.68362 }} | ||
+ | {{#set: organism associated=S.japonica_carotenoid_curated}} | ||
+ | {{#set: nb reaction associated=2}} | ||
+ | {{#set: nb pathway associated=2}} |
Revision as of 09:25, 27 August 2019
Contents
Gene SJ21701
- transcription-direction:
- positive
- right-end-position:
- 1008890
- left-end-position:
- 957947
- centisome-position:
- 84.68362
Organism(s) associated with this gene
Reaction(s) associated
- 2OXOGLUTDECARB-RXN
- Category: annotation
- source: saccharina_japonica_genome; tool: pathwaytools; comment: n.a
- Category: orthology
- source: output_pantograph_ectocarpus_siliculosus; tool: pantograph; comment: n.a
- Category: annotation
- AKGDHmi
- Category: orthology
- source: output_pantograph_nannochloropsis_salina; tool: pantograph; comment: n.a
- Category: orthology
Pathway(s) associated
- PWY66-398
- 10 reactions found over 11 reactions in the full pathway
- PWY-5084
- 3 reactions found over 3 reactions in the full pathway