Difference between revisions of "SJ21602"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ04279 == * transcription-direction: ** positive * right-end-position: ** 46158 * left-end-position: ** 31528 * centisome-position: ** 29.097485...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-596 CPD-596] == * common-name: ** n6,n6-dimethyl-l-arginine * smiles: ** cn(c(=[n+])ncccc([...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-596 CPD-596] == |
− | * | + | * common-name: |
− | ** | + | ** n6,n6-dimethyl-l-arginine |
− | * | + | * smiles: |
− | ** | + | ** cn(c(=[n+])ncccc([n+])c(=o)[o-])c |
− | * | + | * inchi-key: |
− | ** | + | ** ydgmgexadbmomj-lurjtmiesa-o |
− | * | + | * molecular-weight: |
− | ** | + | ** 203.264 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[DIMETHYLARGININASE-RXN]] |
− | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=n6,n6-dimethyl-l-arginine}} | |
− | + | {{#set: inchi-key=inchikey=ydgmgexadbmomj-lurjtmiesa-o}} | |
− | {{#set: | + | {{#set: molecular-weight=203.264}} |
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− |
Revision as of 09:25, 27 August 2019
Contents
Metabolite CPD-596
- common-name:
- n6,n6-dimethyl-l-arginine
- smiles:
- cn(c(=[n+])ncccc([n+])c(=o)[o-])c
- inchi-key:
- ydgmgexadbmomj-lurjtmiesa-o
- molecular-weight:
- 203.264