Difference between revisions of "SJ19606"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-520 CPD-520] == * common-name: ** quercetin * smiles: ** c1(c=c(o)c(o)=cc=1c2(oc3(=c(c(=o)c...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HIS HIS] == * common-name: ** l-histidine * smiles: ** c1(nc=nc=1cc(c(=o)[o-])[n+]) * inchi-key...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HIS HIS] == |
* common-name: | * common-name: | ||
− | ** | + | ** l-histidine |
* smiles: | * smiles: | ||
− | ** c1( | + | ** c1(nc=nc=1cc(c(=o)[o-])[n+]) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** hndvdqjcigzpno-yfkpbyrvsa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 155.156 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[HISTIDINE--TRNA-LIGASE-RXN]] |
− | * [[ | + | * [[HISTIDINE-AMMONIA-LYASE-RXN]] |
− | * [[ | + | * [[HISTIDINE-DECARBOXYLASE-RXN]] |
+ | * [[biomass_rxn]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[HISTALDEHYD-RXN]] |
− | * [[ | + | * [[RXN-8001]] |
+ | * [[RXN0-6978]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=l-histidine}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=hndvdqjcigzpno-yfkpbyrvsa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=155.156}} |
Revision as of 09:25, 27 August 2019
Contents
Metabolite HIS
- common-name:
- l-histidine
- smiles:
- c1(nc=nc=1cc(c(=o)[o-])[n+])
- inchi-key:
- hndvdqjcigzpno-yfkpbyrvsa-n
- molecular-weight:
- 155.156