Difference between revisions of "SJ08886"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ16800 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * RXN0-1061 ** Category:...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NICOTINAMIDE_RIBOSE NICOTINAMIDE_RIBOSE] == * common-name: ** 1-(β-d ribofuranosyl)nicotin...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NICOTINAMIDE_RIBOSE NICOTINAMIDE_RIBOSE] == |
| − | == | + | * common-name: |
| − | * | + | ** 1-(β-d ribofuranosyl)nicotinamide |
| − | == Reaction(s) | + | * smiles: |
| − | * [[ | + | ** c(o)c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)n)c=2)) |
| − | + | * inchi-key: | |
| − | + | ** jlebzpbdrkpwtd-turqnecasa-o | |
| − | {{#set: | + | * molecular-weight: |
| − | {{#set: | + | ** 255.25 |
| + | == Reaction(s) known to consume the compound == | ||
| + | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-5841]] | ||
| + | == Reaction(s) of unknown directionality == | ||
| + | {{#set: common-name=1-(β-d ribofuranosyl)nicotinamide}} | ||
| + | {{#set: inchi-key=inchikey=jlebzpbdrkpwtd-turqnecasa-o}} | ||
| + | {{#set: molecular-weight=255.25}} | ||
Revision as of 09:25, 27 August 2019
Contents
Metabolite NICOTINAMIDE_RIBOSE
- common-name:
- 1-(β-d ribofuranosyl)nicotinamide
- smiles:
- c(o)c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)n)c=2))
- inchi-key:
- jlebzpbdrkpwtd-turqnecasa-o
- molecular-weight:
- 255.25
