Difference between revisions of "SJ20250"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=23-EPOXY-23-DIHYDRO-2-METHYL-14-NAPHTHOQ 23-EPOXY-23-DIHYDRO-2-METHYL-14-NAPHTHOQ] == * common-...")
(Created page with "Category:gene == Gene SJ10005 == * transcription-direction: ** positive * right-end-position: ** 105908 * left-end-position: ** 89266 * centisome-position: ** 22.332468...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=23-EPOXY-23-DIHYDRO-2-METHYL-14-NAPHTHOQ 23-EPOXY-23-DIHYDRO-2-METHYL-14-NAPHTHOQ] ==
+
== Gene SJ10005 ==
* common-name:
+
* transcription-direction:
** vitamin k 2,3-epoxide
+
** positive
* smiles:
+
* right-end-position:
** cc(c)cccc(c)cccc(c)cccc(c)=ccc13(oc(c)(c(=o)c2(c=cc=cc(c(=o)1)=2))3)
+
** 105908
* inchi-key:
+
* left-end-position:
** kutxfbihpwidjq-hbdfacptsa-n
+
** 89266
* molecular-weight:
+
* centisome-position:
** 466.703
+
** 22.332468   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[1.1.4.1-RXN]]
+
* [[S.japonica_carotenoid_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
* [[1.1.4.1-RXN]]
+
* [[PHENYLALANINE--TRNA-LIGASE-RXN]]
== Reaction(s) of unknown directionality ==
+
** Category: [[annotation]]
{{#set: common-name=vitamin k 2,3-epoxide}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: inchi-key=inchikey=kutxfbihpwidjq-hbdfacptsa-n}}
+
** Category: [[orthology]]
{{#set: molecular-weight=466.703}}
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
== Pathway(s) associated ==
 +
* [[TRNA-CHARGING-PWY]]
 +
** '''21''' reactions found over '''21''' reactions in the full pathway
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=105908}}
 +
{{#set: left-end-position=89266}}
 +
{{#set: centisome-position=22.332468    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=1}}
 +
{{#set: nb pathway associated=1}}

Revision as of 09:25, 27 August 2019

Gene SJ10005

  • transcription-direction:
    • positive
  • right-end-position:
    • 105908
  • left-end-position:
    • 89266
  • centisome-position:
    • 22.332468

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated