Difference between revisions of "SJ21782"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ13041 == * transcription-direction: ** positive * right-end-position: ** 8708 * left-end-position: ** 264 * centisome-position: ** 1.8666478 ==...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DITP DITP] == * common-name: ** ditp * smiles: ** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DITP DITP] == |
− | * | + | * common-name: |
− | ** | + | ** ditp |
− | * | + | * smiles: |
− | ** | + | ** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc=nc=23))) |
− | * | + | * inchi-key: |
− | ** | + | ** ufjpaqslhagebl-rrkcrqdmsa-j |
− | * | + | * molecular-weight: |
− | ** | + | ** 488.137 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-14228]] |
− | == Reaction(s) | + | * [[RXN0-1602]] |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-14228]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | {{#set: | + | {{#set: common-name=ditp}} |
− | {{#set: | + | {{#set: inchi-key=inchikey=ufjpaqslhagebl-rrkcrqdmsa-j}} |
− | + | {{#set: molecular-weight=488.137}} | |
− | {{#set: | ||
− | |||
− |
Revision as of 09:25, 27 August 2019
Contents
Metabolite DITP
- common-name:
- ditp
- smiles:
- c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc=nc=23)))
- inchi-key:
- ufjpaqslhagebl-rrkcrqdmsa-j
- molecular-weight:
- 488.137