Difference between revisions of "SJ20166"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Rubisco-lysine Rubisco-lysine] == * common-name: ** a [ribulose-1,5-bisphosphate-carboxylase]-l...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6661 CPD-6661] == * common-name: ** 1d-myo-inositol (1,2,3,4,6)-pentakisphosphate * smiles:...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6661 CPD-6661] == |
* common-name: | * common-name: | ||
− | ** | + | ** 1d-myo-inositol (1,2,3,4,6)-pentakisphosphate |
+ | * smiles: | ||
+ | ** c1(o)(c(op([o-])(=o)[o-])c(op([o-])([o-])=o)c(op([o-])([o-])=o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1) | ||
+ | * inchi-key: | ||
+ | ** ctpqaxvnygzuaj-qwbqgljisa-d | ||
+ | * molecular-weight: | ||
+ | ** 569.977 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-7186]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-7186]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=1d-myo-inositol (1,2,3,4,6)-pentakisphosphate}} |
+ | {{#set: inchi-key=inchikey=ctpqaxvnygzuaj-qwbqgljisa-d}} | ||
+ | {{#set: molecular-weight=569.977}} |
Revision as of 14:19, 26 August 2019
Contents
Metabolite CPD-6661
- common-name:
- 1d-myo-inositol (1,2,3,4,6)-pentakisphosphate
- smiles:
- c1(o)(c(op([o-])(=o)[o-])c(op([o-])([o-])=o)c(op([o-])([o-])=o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1)
- inchi-key:
- ctpqaxvnygzuaj-qwbqgljisa-d
- molecular-weight:
- 569.977