Difference between revisions of "SJ20166"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Rubisco-lysine Rubisco-lysine] == * common-name: ** a [ribulose-1,5-bisphosphate-carboxylase]-l...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6661 CPD-6661] == * common-name: ** 1d-myo-inositol (1,2,3,4,6)-pentakisphosphate * smiles:...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Rubisco-lysine Rubisco-lysine] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6661 CPD-6661] ==
 
* common-name:
 
* common-name:
** a [ribulose-1,5-bisphosphate-carboxylase]-lysine
+
** 1d-myo-inositol (1,2,3,4,6)-pentakisphosphate
 +
* smiles:
 +
** c1(o)(c(op([o-])(=o)[o-])c(op([o-])([o-])=o)c(op([o-])([o-])=o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1)
 +
* inchi-key:
 +
** ctpqaxvnygzuaj-qwbqgljisa-d
 +
* molecular-weight:
 +
** 569.977
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.1.1.127-RXN]]
+
* [[RXN-7186]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-7186]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [ribulose-1,5-bisphosphate-carboxylase]-lysine}}
+
{{#set: common-name=1d-myo-inositol (1,2,3,4,6)-pentakisphosphate}}
 +
{{#set: inchi-key=inchikey=ctpqaxvnygzuaj-qwbqgljisa-d}}
 +
{{#set: molecular-weight=569.977}}

Revision as of 14:19, 26 August 2019

Metabolite CPD-6661

  • common-name:
    • 1d-myo-inositol (1,2,3,4,6)-pentakisphosphate
  • smiles:
    • c1(o)(c(op([o-])(=o)[o-])c(op([o-])([o-])=o)c(op([o-])([o-])=o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1)
  • inchi-key:
    • ctpqaxvnygzuaj-qwbqgljisa-d
  • molecular-weight:
    • 569.977

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality