Difference between revisions of "SJ02472"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Holo-EntF Holo-EntF] == * common-name: ** a holo-[entf peptidyl-carrier protein] == Reaction(s)...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BETA-D-GALACTOSYL-ETCETERA-GLUCOSAMINE BETA-D-GALACTOSYL-ETCETERA-GLUCOSAMINE] == * common-name...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Holo-EntF Holo-EntF] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BETA-D-GALACTOSYL-ETCETERA-GLUCOSAMINE BETA-D-GALACTOSYL-ETCETERA-GLUCOSAMINE] ==
 
* common-name:
 
* common-name:
** a holo-[entf peptidyl-carrier protein]
+
** β-d-galactosyl-(1→4)-n-acetyl-d-glucosamine
 +
* smiles:
 +
** cc(=o)nc2(c(o)oc(co)c(oc1(oc(co)c(o)c(o)c(o)1))c(o)2)
 +
* inchi-key:
 +
** kfeujdwyngmdbv-rphkzzmbsa-n
 +
* molecular-weight:
 +
** 383.352
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-15268]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15889]]
+
* [[N-ACETYLLACTOSAMINE-SYNTHASE-RXN]]
 +
* [[RXN-15268]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a holo-[entf peptidyl-carrier protein]}}
+
{{#set: common-name=β-d-galactosyl-(1→4)-n-acetyl-d-glucosamine}}
 +
{{#set: inchi-key=inchikey=kfeujdwyngmdbv-rphkzzmbsa-n}}
 +
{{#set: molecular-weight=383.352}}

Revision as of 14:19, 26 August 2019

Metabolite BETA-D-GALACTOSYL-ETCETERA-GLUCOSAMINE

  • common-name:
    • β-d-galactosyl-(1→4)-n-acetyl-d-glucosamine
  • smiles:
    • cc(=o)nc2(c(o)oc(co)c(oc1(oc(co)c(o)c(o)c(o)1))c(o)2)
  • inchi-key:
    • kfeujdwyngmdbv-rphkzzmbsa-n
  • molecular-weight:
    • 383.352

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality