Difference between revisions of "SJ02536"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15301 CPD-15301] == * common-name: ** caldariellaquinol * smiles: ** cc(c)cccc(c)cccc(c)ccc...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2171 CPD0-2171] == * common-name: ** (s)-3-hydroxytetradecanoyl-coa * smiles: ** ccccccccc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15301 CPD-15301] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2171 CPD0-2171] ==
 
* common-name:
 
* common-name:
** caldariellaquinol
+
** (s)-3-hydroxytetradecanoyl-coa
 
* smiles:
 
* smiles:
** cc(c)cccc(c)cccc(c)cccc(c)cccc(c)cccc(c)ccc2(c(sc)=c(o)c1(=c(sc=c1)c(o)=2))
+
** cccccccccccc(o)cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o
 
* inchi-key:
 
* inchi-key:
** uvcqokdzgiahdg-uhfffaoysa-n
+
** oxbhkmhndgrdcz-stlsenowsa-j
 
* molecular-weight:
 
* molecular-weight:
** 633.085
+
** 989.861
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[ECOAH6h]]
 +
* [[HACD6h]]
 +
* [[RXN-12507]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15378]]
+
* [[ECOAH6h]]
 +
* [[HACD6h]]
 +
* [[RXN-14273]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=caldariellaquinol}}
+
{{#set: common-name=(s)-3-hydroxytetradecanoyl-coa}}
{{#set: inchi-key=inchikey=uvcqokdzgiahdg-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=oxbhkmhndgrdcz-stlsenowsa-j}}
{{#set: molecular-weight=633.085}}
+
{{#set: molecular-weight=989.861}}

Revision as of 14:19, 26 August 2019

Metabolite CPD0-2171

  • common-name:
    • (s)-3-hydroxytetradecanoyl-coa
  • smiles:
    • cccccccccccc(o)cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o
  • inchi-key:
    • oxbhkmhndgrdcz-stlsenowsa-j
  • molecular-weight:
    • 989.861

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality