Difference between revisions of "SJ12469"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2231 CPD0-2231] == * common-name: ** didp * smiles: ** c(op(=o)([o-])op(=o)([o-])[o-])c1(o...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-EPINEPHRINE L-EPINEPHRINE] == * common-name: ** (r)-adrenaline * smiles: ** c[n+]cc(o)c1(c=cc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-EPINEPHRINE L-EPINEPHRINE] == |
* common-name: | * common-name: | ||
| − | ** | + | ** (r)-adrenaline |
* smiles: | * smiles: | ||
| − | ** c | + | ** c[n+]cc(o)c1(c=cc(=c(c=1)o)o) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** uctwmzqnuqwslp-vifpvbqesa-o |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 184.214 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-10908]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(r)-adrenaline}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=uctwmzqnuqwslp-vifpvbqesa-o}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=184.214}} |
Revision as of 14:19, 26 August 2019
Contents
Metabolite L-EPINEPHRINE
- common-name:
- (r)-adrenaline
- smiles:
- c[n+]cc(o)c1(c=cc(=c(c=1)o)o)
- inchi-key:
- uctwmzqnuqwslp-vifpvbqesa-o
- molecular-weight:
- 184.214
