Difference between revisions of "SJ09219"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-3-CARBOXY-3-METHYLAMMONIOPROPYL-L- 2-3-CARBOXY-3-METHYLAMMONIOPROPYL-L-] == * common-name: **...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P3I P3I] == * common-name: ** pppi * smiles: ** [o-]p(op(=o)(op([o-])(=o)[o-])[o-])([o-])=o * i...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P3I P3I] == |
* common-name: | * common-name: | ||
| − | ** | + | ** pppi |
| + | * smiles: | ||
| + | ** [o-]p(op(=o)(op([o-])(=o)[o-])[o-])([o-])=o | ||
| + | * inchi-key: | ||
| + | ** unxrwkveancorm-uhfffaoysa-i | ||
| + | * molecular-weight: | ||
| + | ** 252.915 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[TRIPHOSPHATASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[4.2.3.12-RXN]] |
| + | * [[BTUR2-RXN]] | ||
| + | * [[COBALADENOSYLTRANS-RXN]] | ||
| + | * [[DGTPTRIPHYDRO-RXN]] | ||
| + | * [[R344-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=pppi}} |
| + | {{#set: inchi-key=inchikey=unxrwkveancorm-uhfffaoysa-i}} | ||
| + | {{#set: molecular-weight=252.915}} | ||
Revision as of 14:19, 26 August 2019
Contents
Metabolite P3I
- common-name:
- pppi
- smiles:
- [o-]p(op(=o)(op([o-])(=o)[o-])[o-])([o-])=o
- inchi-key:
- unxrwkveancorm-uhfffaoysa-i
- molecular-weight:
- 252.915
