Difference between revisions of "SJ00580"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=B-Gal-14-NacGlc-R B-Gal-14-NacGlc-R] == * common-name: ** a type 2 histo-blood group antigen pr...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-126 CPD1F-126] == * common-name: ** γ-carotene * smiles: ** cc(=cccc(=cc=cc(=cc=cc(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=B-Gal-14-NacGlc-R B-Gal-14-NacGlc-R] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-126 CPD1F-126] ==
 
* common-name:
 
* common-name:
** a type 2 histo-blood group antigen precursor disaccharide
+
** γ-carotene
 +
* smiles:
 +
** cc(=cccc(=cc=cc(=cc=cc(=cc=cc=c(c=cc=c(c=cc1(c(c)(c)cccc=1c))c)c)c)c)c)c
 +
* inchi-key:
 +
** hrqkoyfghjyefs-bxolysjbsa-n
 +
* molecular-weight:
 +
** 536.882
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.4.1.151-RXN]]
+
* [[RXN1F-151]]
* [[GALACTOSIDE-3-FUCOSYLTRANSFERASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.4.1.38-RXN]]
+
* [[RXN1F-150]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a type 2 histo-blood group antigen precursor disaccharide}}
+
{{#set: common-name=γ-carotene}}
 +
{{#set: inchi-key=inchikey=hrqkoyfghjyefs-bxolysjbsa-n}}
 +
{{#set: molecular-weight=536.882}}

Revision as of 14:19, 26 August 2019

Metabolite CPD1F-126

  • common-name:
    • γ-carotene
  • smiles:
    • cc(=cccc(=cc=cc(=cc=cc(=cc=cc=c(c=cc=c(c=cc1(c(c)(c)cccc=1c))c)c)c)c)c)c
  • inchi-key:
    • hrqkoyfghjyefs-bxolysjbsa-n
  • molecular-weight:
    • 536.882

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality