Difference between revisions of "SJ04502"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10420 CPD-10420] == * common-name: ** 4-sulfomuconolactone * smiles: ** c([o-])(=o)cc1(s(=o...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-1-PHOSPHATIDYL-ETHANOLAMINE L-1-PHOSPHATIDYL-ETHANOLAMINE] == * common-name: ** an l-1-phosph...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10420 CPD-10420] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-1-PHOSPHATIDYL-ETHANOLAMINE L-1-PHOSPHATIDYL-ETHANOLAMINE] ==
 
* common-name:
 
* common-name:
** 4-sulfomuconolactone
+
** an l-1-phosphatidylethanolamine
* smiles:
 
** c([o-])(=o)cc1(s(=o)(=o)[o-])(c=cc(=o)o1)
 
* inchi-key:
 
** weeoykxhmipyqx-uhfffaoysa-l
 
* molecular-weight:
 
** 220.153
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9733]]
+
* [[2.1.1.17-RXN]]
 +
* [[RXN-1382]]
 +
* [[RXN0-6725]]
 +
* [[RXN0-6952]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[ETHANOLAMINEPHOSPHOTRANSFERASE-RXN]]
 +
* [[RXN-1382]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-sulfomuconolactone}}
+
{{#set: common-name=an l-1-phosphatidylethanolamine}}
{{#set: inchi-key=inchikey=weeoykxhmipyqx-uhfffaoysa-l}}
 
{{#set: molecular-weight=220.153}}
 

Revision as of 14:19, 26 August 2019

Metabolite L-1-PHOSPHATIDYL-ETHANOLAMINE

  • common-name:
    • an l-1-phosphatidylethanolamine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality