Difference between revisions of "SJ16976"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15654 CPD-15654] == * common-name: ** 2-trans, 4-cis-undecadienoyl-coa * smiles: ** ccccccc...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-659 CPD-659] == * common-name: ** l-arogenate * smiles: ** c(c(cc1(c=cc(c=c1)o)c([o-])=o)[n...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15654 CPD-15654] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-659 CPD-659] ==
 
* common-name:
 
* common-name:
** 2-trans, 4-cis-undecadienoyl-coa
+
** l-arogenate
 
* smiles:
 
* smiles:
** ccccccc=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** c(c(cc1(c=cc(c=c1)o)c([o-])=o)[n+])([o-])=o
 
* inchi-key:
 
* inchi-key:
** szkpluulggerfd-nfpsboapsa-j
+
** mieildywganznh-dsquftabsa-m
 
* molecular-weight:
 
* molecular-weight:
** 927.749
+
** 226.208
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14776]]
+
* [[PREPHENATE-ASP-TRANSAMINE-RXN]]
 +
* [[PREPHENATE-TRANSAMINE-RXN]]
 +
* [[RXN-5682]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14775]]
+
* [[PREPHENATE-ASP-TRANSAMINE-RXN]]
 +
* [[PREPHENATE-TRANSAMINE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-trans, 4-cis-undecadienoyl-coa}}
+
{{#set: common-name=l-arogenate}}
{{#set: inchi-key=inchikey=szkpluulggerfd-nfpsboapsa-j}}
+
{{#set: inchi-key=inchikey=mieildywganznh-dsquftabsa-m}}
{{#set: molecular-weight=927.749}}
+
{{#set: molecular-weight=226.208}}

Revision as of 14:20, 26 August 2019

Metabolite CPD-659

  • common-name:
    • l-arogenate
  • smiles:
    • c(c(cc1(c=cc(c=c1)o)c([o-])=o)[n+])([o-])=o
  • inchi-key:
    • mieildywganznh-dsquftabsa-m
  • molecular-weight:
    • 226.208

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality