Difference between revisions of "SJ14618"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TUM1-S-sulfanylcysteine TUM1-S-sulfanylcysteine] == * common-name: ** a [3-mercaptopyruvate sul...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-INDOLYLGLYCOLALDEHYDE 3-INDOLYLGLYCOLALDEHYDE] == * common-name: ** indole-3-glycol aldehyde...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TUM1-S-sulfanylcysteine TUM1-S-sulfanylcysteine] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-INDOLYLGLYCOLALDEHYDE 3-INDOLYLGLYCOLALDEHYDE] ==
 
* common-name:
 
* common-name:
** a [3-mercaptopyruvate sulfurtransferase]-s-sulfanyl-l-cysteine
+
** indole-3-glycol aldehyde
 +
* smiles:
 +
** c2(=c(c1(c=cc=cc=1n2))c(o)c=o)
 +
* inchi-key:
 +
** xkzdnwmdlgqxml-uhfffaoysa-n
 +
* molecular-weight:
 +
** 175.187
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16821]]
+
* [[RXN-5424]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [3-mercaptopyruvate sulfurtransferase]-s-sulfanyl-l-cysteine}}
+
{{#set: common-name=indole-3-glycol aldehyde}}
 +
{{#set: inchi-key=inchikey=xkzdnwmdlgqxml-uhfffaoysa-n}}
 +
{{#set: molecular-weight=175.187}}

Revision as of 14:20, 26 August 2019

Metabolite 3-INDOLYLGLYCOLALDEHYDE

  • common-name:
    • indole-3-glycol aldehyde
  • smiles:
    • c2(=c(c1(c=cc=cc=1n2))c(o)c=o)
  • inchi-key:
    • xkzdnwmdlgqxml-uhfffaoysa-n
  • molecular-weight:
    • 175.187

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality