Difference between revisions of "SJ11682"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-170 CPD-170] == * common-name: ** stachyose * smiles: ** c(o)c1(c(o)c(o)c(o)c(o1)occ4(c(o)c...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LIPOIC-ACID LIPOIC-ACID] == * common-name: ** (r)-lipoate * smiles: ** c(ccc(=o)[o-])cc1(ccss1)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-170 CPD-170] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LIPOIC-ACID LIPOIC-ACID] ==
 
* common-name:
 
* common-name:
** stachyose
+
** (r)-lipoate
 
* smiles:
 
* smiles:
** c(o)c1(c(o)c(o)c(o)c(o1)occ4(c(o)c(o)c(o)c(occ3(c(o)c(o)c(o)c(oc2(co)(c(o)c(o)c(co)o2))o3))o4))
+
** c(ccc(=o)[o-])cc1(ccss1)
 
* inchi-key:
 
* inchi-key:
** uqziybxshagnoe-xnsrjbnmsa-n
+
** agbqknbqesqnjd-ssdottswsa-m
 
* molecular-weight:
 
* molecular-weight:
** 666.583
+
** 205.309
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.4.1.67-RXN]]
+
* [[RXN-17127]]
* [[RXN-11501]]
+
* [[RXN-8654]]
 +
* [[RXN0-1141]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.4.1.67-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=stachyose}}
+
{{#set: common-name=(r)-lipoate}}
{{#set: inchi-key=inchikey=uqziybxshagnoe-xnsrjbnmsa-n}}
+
{{#set: inchi-key=inchikey=agbqknbqesqnjd-ssdottswsa-m}}
{{#set: molecular-weight=666.583}}
+
{{#set: molecular-weight=205.309}}

Revision as of 14:20, 26 August 2019

Metabolite LIPOIC-ACID

  • common-name:
    • (r)-lipoate
  • smiles:
    • c(ccc(=o)[o-])cc1(ccss1)
  • inchi-key:
    • agbqknbqesqnjd-ssdottswsa-m
  • molecular-weight:
    • 205.309

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality