Difference between revisions of "SJ01938"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=16-HYDROXYPALMITATE 16-HYDROXYPALMITATE] == * common-name: ** 16-hydroxypalmitate * smiles: **...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7206 CPD-7206] == * common-name: ** 8'-apo-β-carotenal * smiles: ** cc(c=cc=c(c=cc1(c(...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7206 CPD-7206] == |
* common-name: | * common-name: | ||
− | ** | + | ** 8'-apo-β-carotenal |
* smiles: | * smiles: | ||
− | ** c( | + | ** cc(c=cc=c(c=cc1(c(cccc=1c)(c)c))c)=cc=cc=c(c=cc=c(c=o)c)c |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** dfmmvlfmmaqxhz-dokbywhisa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 416.645 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-11783]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=8'-apo-β-carotenal}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=dfmmvlfmmaqxhz-dokbywhisa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=416.645}} |
Revision as of 14:20, 26 August 2019
Contents
Metabolite CPD-7206
- common-name:
- 8'-apo-β-carotenal
- smiles:
- cc(c=cc=c(c=cc1(c(cccc=1c)(c)c))c)=cc=cc=c(c=cc=c(c=o)c)c
- inchi-key:
- dfmmvlfmmaqxhz-dokbywhisa-n
- molecular-weight:
- 416.645