Difference between revisions of "SJ22496"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FERULOYL-COA FERULOYL-COA] == * common-name: ** feruloyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IMIDAZOLE-ACETOL-P IMIDAZOLE-ACETOL-P] == * common-name: ** imidazole acetol-phosphate * smiles...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FERULOYL-COA FERULOYL-COA] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IMIDAZOLE-ACETOL-P IMIDAZOLE-ACETOL-P] ==
 
* common-name:
 
* common-name:
** feruloyl-coa
+
** imidazole acetol-phosphate
 
* smiles:
 
* smiles:
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=c(oc)c(o)=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
+
** c1(nc=nc=1cc(cop([o-])(=o)[o-])=o)
 
* inchi-key:
 
* inchi-key:
** gbxzvjqqdajgso-nbxnmegssa-j
+
** ycffmsolumramd-uhfffaoysa-l
 
* molecular-weight:
 
* molecular-weight:
** 939.674
+
** 218.105
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-1106]]
+
* [[HISTAMINOTRANS-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[6.2.1.34-RXN]]
+
* [[HISTAMINOTRANS-RXN]]
* [[CAFFEOYL-COA-O-METHYLTRANSFERASE-RXN]]
+
* [[IGPD]]
 +
* [[IMIDPHOSDEHYD-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=feruloyl-coa}}
+
{{#set: common-name=imidazole acetol-phosphate}}
{{#set: inchi-key=inchikey=gbxzvjqqdajgso-nbxnmegssa-j}}
+
{{#set: inchi-key=inchikey=ycffmsolumramd-uhfffaoysa-l}}
{{#set: molecular-weight=939.674}}
+
{{#set: molecular-weight=218.105}}

Revision as of 14:20, 26 August 2019

Metabolite IMIDAZOLE-ACETOL-P

  • common-name:
    • imidazole acetol-phosphate
  • smiles:
    • c1(nc=nc=1cc(cop([o-])(=o)[o-])=o)
  • inchi-key:
    • ycffmsolumramd-uhfffaoysa-l
  • molecular-weight:
    • 218.105

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality