Difference between revisions of "SJ16094"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHE PHE] == * common-name: ** l-phenylalanine * smiles: ** c([o-])(=o)c([n+])cc1(c=cc=cc=1) * i...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-592 CPD-592] == * common-name: ** 4-guanidinobutanoate * smiles: ** c([o-])(=o)cccnc(=[n+])...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-592 CPD-592] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 4-guanidinobutanoate |
* smiles: | * smiles: | ||
| − | ** c([o-])(=o) | + | ** c([o-])(=o)cccnc(=[n+])n |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** tuhveajximeosa-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 145.161 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[GUANIDINOBUTANAMIDE-NH3-RXN]] |
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=4-guanidinobutanoate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=tuhveajximeosa-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=145.161}} |
Revision as of 14:20, 26 August 2019
Contents
Metabolite CPD-592
- common-name:
- 4-guanidinobutanoate
- smiles:
- c([o-])(=o)cccnc(=[n+])n
- inchi-key:
- tuhveajximeosa-uhfffaoysa-n
- molecular-weight:
- 145.161
