Difference between revisions of "SJ06911"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-606 CPD-606] == * common-name: ** cdp-glycerol * smiles: ** c(o)c(o)cop(op(occ2(c(c(c(n1(c(...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3617 CPD-3617] == * common-name: ** decanoate * smiles: ** cccccccccc(=o)[o-] * inchi-key:...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-606 CPD-606] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3617 CPD-3617] ==
 
* common-name:
 
* common-name:
** cdp-glycerol
+
** decanoate
 
* smiles:
 
* smiles:
** c(o)c(o)cop(op(occ2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))(=o)[o-])(=o)[o-]
+
** cccccccccc(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** hhpouccvoneprk-jbsykwbfsa-l
+
** ghvnfzfcnzkvnt-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 475.242
+
** 171.259
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[CDP-GLYCEROL-PYROPHOSPHATASE-RXN]]
+
* [[RXN-13614]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[CDP-GLYCEROL-PYROPHOSPHATASE-RXN]]
+
* [[RXN-16653]]
 +
* [[RXN-9628]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=cdp-glycerol}}
+
{{#set: common-name=decanoate}}
{{#set: inchi-key=inchikey=hhpouccvoneprk-jbsykwbfsa-l}}
+
{{#set: inchi-key=inchikey=ghvnfzfcnzkvnt-uhfffaoysa-m}}
{{#set: molecular-weight=475.242}}
+
{{#set: molecular-weight=171.259}}

Revision as of 14:20, 26 August 2019

Metabolite CPD-3617

  • common-name:
    • decanoate
  • smiles:
    • cccccccccc(=o)[o-]
  • inchi-key:
    • ghvnfzfcnzkvnt-uhfffaoysa-m
  • molecular-weight:
    • 171.259

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality