Difference between revisions of "SJ05313"

Revision as of 14:20, 26 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11409 CPD-11409] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NITRATE NITRATE] ==
 * common-name:
-** tetraiodothyroacetate ether glucuronide
+** nitrate
 * smiles:
-** c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc3(=cc(i)=c(oc2(oc(c([o-])=o)c(o)c(o)c(o)2))c(i)=c3))
+** n(=o)(=o)[o-]
 * inchi-key:
-** gyorpzqlvmnogy-rupwjetcsa-l
+** nhnbfggvmkefgy-uhfffaoysa-n
 * molecular-weight:
-** 921.943
+** 62.005
 == Reaction(s) known to consume the compound ==
+* [[ExchangeSeed-NITRATE]]
+* [[NITRATE-REDUCTASE-NADH-RXN]]
+* [[NITRATE-REDUCTASE-NADPH-RXN]]
+* [[NITRATE-REDUCTASE-NADPORNOPH-RXN]]
+* [[NITRATREDUCT-RXN]]
+* [[NO3t]]
+* [[TCV3]]
+* [[TransportSeed-NITRATE]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-10616]]
+* [[ExchangeSeed-NITRATE]]
+* [[NITRATREDUCT-RXN]]
+* [[NO3t]]
+* [[NODOx]]
+* [[NODOy]]
+* [[R621-RXN]]
+* [[TCV3]]
+* [[TransportSeed-NITRATE]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=tetraiodothyroacetate ether glucuronide}}
+{{#set: common-name=nitrate}}
-{{#set: inchi-key=inchikey=gyorpzqlvmnogy-rupwjetcsa-l}}
+{{#set: inchi-key=inchikey=nhnbfggvmkefgy-uhfffaoysa-n}}
-{{#set: molecular-weight=921.943}}
+{{#set: molecular-weight=62.005}}