Difference between revisions of "SJ10173"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8078 CPD-8078] == * common-name: ** 1-18:3-2-16:2-monogalactosyldiacylglycerol * smiles: **...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-SEROTONIN N-ACETYL-SEROTONIN] == * common-name: ** n-acetyl-serotonin * smiles: ** cc(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8078 CPD-8078] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-SEROTONIN N-ACETYL-SEROTONIN] ==
 
* common-name:
 
* common-name:
** 1-18:3-2-16:2-monogalactosyldiacylglycerol
+
** n-acetyl-serotonin
 
* smiles:
 
* smiles:
** ccc=ccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccc=cccccc)=o)=o
+
** cc(=o)nccc2(=cnc1(=c(c=c(o)c=c1)2))
 
* inchi-key:
 
* inchi-key:
** wsmybuvbfwdmec-sbpcighssa-n
+
** mvawjsidnickhf-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 749.036
+
** 218.255
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8309]]
+
* [[RXN-11059]]
 +
* [[RXN-11060]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8299]]
+
* [[RXN-11057]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-18:3-2-16:2-monogalactosyldiacylglycerol}}
+
{{#set: common-name=n-acetyl-serotonin}}
{{#set: inchi-key=inchikey=wsmybuvbfwdmec-sbpcighssa-n}}
+
{{#set: inchi-key=inchikey=mvawjsidnickhf-uhfffaoysa-n}}
{{#set: molecular-weight=749.036}}
+
{{#set: molecular-weight=218.255}}

Revision as of 14:20, 26 August 2019

Metabolite N-ACETYL-SEROTONIN

  • common-name:
    • n-acetyl-serotonin
  • smiles:
    • cc(=o)nccc2(=cnc1(=c(c=c(o)c=c1)2))
  • inchi-key:
    • mvawjsidnickhf-uhfffaoysa-n
  • molecular-weight:
    • 218.255

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality