Difference between revisions of "SJ10722"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17280 CPD-17280] == * common-name: ** a [glycerolipid]-((9z,12z)-octadecadien-6-ynoate == R...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3569 CPD-3569] == * common-name: ** glycyl-l-glutamate * smiles: ** c([n+])c(=o)nc(ccc(=o)[...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3569 CPD-3569] == |
* common-name: | * common-name: | ||
| − | ** | + | ** glycyl-l-glutamate |
| + | * smiles: | ||
| + | ** c([n+])c(=o)nc(ccc(=o)[o-])c([o-])=o | ||
| + | * inchi-key: | ||
| + | ** iefjwdngdzaynz-bypyzucnsa-m | ||
| + | * molecular-weight: | ||
| + | ** 203.174 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN0-6984]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=glycyl-l-glutamate}} |
| + | {{#set: inchi-key=inchikey=iefjwdngdzaynz-bypyzucnsa-m}} | ||
| + | {{#set: molecular-weight=203.174}} | ||
Revision as of 14:20, 26 August 2019
Contents
Metabolite CPD-3569
- common-name:
- glycyl-l-glutamate
- smiles:
- c([n+])c(=o)nc(ccc(=o)[o-])c([o-])=o
- inchi-key:
- iefjwdngdzaynz-bypyzucnsa-m
- molecular-weight:
- 203.174
