Difference between revisions of "SJ17066"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19167 CPD-19167] == * common-name: ** 3-oxo-(7z)-hexadecenoyl-coa * smiles: ** ccccccccc=cc...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NN-dimethyl-terminal-XPK NN-dimethyl-terminal-XPK] == * common-name: ** an n terminal n,n-dimet...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19167 CPD-19167] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NN-dimethyl-terminal-XPK NN-dimethyl-terminal-XPK] ==
 
* common-name:
 
* common-name:
** 3-oxo-(7z)-hexadecenoyl-coa
+
** an n terminal n,n-dimethyl-(a/s)pk-[protein]
* smiles:
 
** ccccccccc=ccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** bucifqoxnyheoo-ydggzukgsa-j
 
* molecular-weight:
 
** 1013.883
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17782]]
+
* [[RXN-13224]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17781]]
+
* [[RXN-12890]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-(7z)-hexadecenoyl-coa}}
+
{{#set: common-name=an n terminal n,n-dimethyl-(a/s)pk-[protein]}}
{{#set: inchi-key=inchikey=bucifqoxnyheoo-ydggzukgsa-j}}
 
{{#set: molecular-weight=1013.883}}
 

Revision as of 14:20, 26 August 2019

Metabolite NN-dimethyl-terminal-XPK

  • common-name:
    • an n terminal n,n-dimethyl-(a/s)pk-[protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an n terminal n,n-dimethyl-(a/s)pk-[protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.