Difference between revisions of "SJ13854"

Revision as of 14:20, 26 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7025 CPD-7025] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-SUCCINYLLL-2-6-DIAMINOPIMELATE N-SUCCINYLLL-2-6-DIAMINOPIMELATE] ==
 * common-name:
-** phytyl monophosphate
+** n-succinyl-l,l-2,6-diaminopimelate
 * smiles:
-** cc(cccc(cccc(c)cccc(c)=ccop([o-])(=o)[o-])c)c
+** c(cc([n+])c(=o)[o-])cc(nc(ccc([o-])=o)=o)c([o-])=o
 * inchi-key:
-** yrxrhzokdfcxib-pyddkjgssa-l
+** glxuwzbupatpbr-bqbzgakwsa-l
 * molecular-weight:
-** 374.499
+** 288.257
 == Reaction(s) known to consume the compound ==
+* [[SUCCINYLDIAMINOPIMTRANS-RXN]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-7683]]
+* [[SUCCINYLDIAMINOPIMTRANS-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=phytyl monophosphate}}
+{{#set: common-name=n-succinyl-l,l-2,6-diaminopimelate}}
-{{#set: inchi-key=inchikey=yrxrhzokdfcxib-pyddkjgssa-l}}
+{{#set: inchi-key=inchikey=glxuwzbupatpbr-bqbzgakwsa-l}}
-{{#set: molecular-weight=374.499}}
+{{#set: molecular-weight=288.257}}