Difference between revisions of "SJ18555"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14553 CPD-14553] == * common-name: ** udp-α-d-galactose * smiles: ** c(o)c1(c(o)c(o)c...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-1-P GLC-1-P] == * common-name: ** α-d-glucopyranose 1-phosphate * smiles: ** c(o)c1(o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14553 CPD-14553] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-1-P GLC-1-P] ==
 
* common-name:
 
* common-name:
** udp-α-d-galactose
+
** α-d-glucopyranose 1-phosphate
 
* smiles:
 
* smiles:
** c(o)c1(c(o)c(o)c(o)c(o1)op(op(=o)([o-])occ2(oc(c(o)c(o)2)n3(c=cc(=o)nc(=o)3)))([o-])=o)
+
** c(o)c1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1)
 
* inchi-key:
 
* inchi-key:
** hscjrczfdfqwrp-abvwguqpsa-l
+
** hxxfsfrbohsimq-vfuothlcsa-l
 
* molecular-weight:
 
* molecular-weight:
** 564.289
+
** 258.121
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 
* [[2.4.1.122-RXN]]
 
* [[2.4.1.123-RXN]]
 
* [[2.4.1.134-RXN]]
 
* [[2.4.1.151-RXN]]
 
* [[2.4.1.38-RXN]]
 
* [[2.4.1.46-RXN]]
 
 
* [[GALACTURIDYLYLTRANS-RXN]]
 
* [[GALACTURIDYLYLTRANS-RXN]]
* [[LACTOSE-SYNTHASE-RXN]]
+
* [[GLUC1PURIDYLTRANS-RXN]]
* [[N-ACETYLLACTOSAMINE-SYNTHASE-RXN]]
+
* [[PGCM]]
* [[RXN-1225]]
+
* [[PGMTh]]
* [[RXN-14561]]
+
* [[PHOSPHOGLUCMUT-RXN]]
* [[RXN-15276]]
+
* [[RXN-12486]]
* [[RXN-15277]]
+
* [[RXN-16997]]
* [[RXN-15278]]
+
* [[RXN4FS-13]]
* [[RXN-16027]]
+
* [[UG1PUT]]
* [[RXN-18266]]
 
* [[RXN-18302]]
 
* [[UDPGALtg]]
 
* [[UDPGALth]]
 
* [[UDPGLUCEPIM-RXN]]
 
* [[UG4E]]
 
* [[UTPHEXPURIDYLYLTRANS-RXN]]
 
</div>
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
* [[GALACTURIDYLYLTRANS-RXN]]
 
* [[GALACTURIDYLYLTRANS-RXN]]
* [[RXN-16027]]
+
* [[GLUC1PURIDYLTRANS-RXN]]
* [[UDPGALtg]]
+
* [[GLYCOPHOSPHORYL-RXN]]
* [[UDPGALth]]
+
* [[GLYMALTOPHOSPHORYL-RXN]]
* [[UDPGLUCEPIM-RXN]]
+
* [[PGCM]]
* [[UG4E]]
+
* [[PGMTh]]
* [[UTPHEXPURIDYLYLTRANS-RXN]]
+
* [[PHOSPHOGLUCMUT-RXN]]
 +
* [[RXN-12171]]
 +
* [[RXN-12392]]
 +
* [[RXN-12486]]
 +
* [[RXN-14284]]
 +
* [[RXN-14285]]
 +
* [[RXN-14286]]
 +
* [[RXN-14353]]
 +
* [[RXN-1826]]
 +
* [[RXN-9025]]
 +
* [[RXN0-5182]]
 +
* [[RXN0-5184]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=udp-&alpha;-d-galactose}}
+
{{#set: common-name=&alpha;-d-glucopyranose 1-phosphate}}
{{#set: inchi-key=inchikey=hscjrczfdfqwrp-abvwguqpsa-l}}
+
{{#set: inchi-key=inchikey=hxxfsfrbohsimq-vfuothlcsa-l}}
{{#set: molecular-weight=564.289}}
+
{{#set: molecular-weight=258.121}}

Revision as of 14:20, 26 August 2019

Metabolite GLC-1-P

  • common-name:
    • α-d-glucopyranose 1-phosphate
  • smiles:
    • c(o)c1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1)
  • inchi-key:
    • hxxfsfrbohsimq-vfuothlcsa-l
  • molecular-weight:
    • 258.121

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality