Difference between revisions of "SJ08884"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7107 CPD-7107] == * common-name: ** deoxycohumulone * smiles: ** cc(=ccc1(=c(c(=c(c(=c1[o-]...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12932 CPD-12932] == * common-name: ** all-trans-3,4-didehydrolycopene * smiles: ** cc(c)=cc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7107 CPD-7107] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12932 CPD-12932] ==
 
* common-name:
 
* common-name:
** deoxycohumulone
+
** all-trans-3,4-didehydrolycopene
 
* smiles:
 
* smiles:
** cc(=ccc1(=c(c(=c(c(=c1[o-])cc=c(c)c)o)c(c(c)c)=o)o))c
+
** cc(c)=cc=cc(c)=cc=cc(c)=cc=cc(c)=cc=cc=c(c)c=cc=c(c)c=cc=c(c)ccc=c(c)c
 
* inchi-key:
 
* inchi-key:
** kkfizykkqlwbkh-uhfffaoysa-m
+
** ocmsupsdvxkdfy-fqmrbfjqsa-n
 
* molecular-weight:
 
* molecular-weight:
** 331.431
+
** 534.867
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-11976]]
 +
* [[RXN-11999]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7813]]
+
* [[RXN-12413]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=deoxycohumulone}}
+
{{#set: common-name=all-trans-3,4-didehydrolycopene}}
{{#set: inchi-key=inchikey=kkfizykkqlwbkh-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=ocmsupsdvxkdfy-fqmrbfjqsa-n}}
{{#set: molecular-weight=331.431}}
+
{{#set: molecular-weight=534.867}}

Revision as of 14:20, 26 August 2019

Metabolite CPD-12932

  • common-name:
    • all-trans-3,4-didehydrolycopene
  • smiles:
    • cc(c)=cc=cc(c)=cc=cc(c)=cc=cc(c)=cc=cc=c(c)c=cc=c(c)c=cc=c(c)ccc=c(c)c
  • inchi-key:
    • ocmsupsdvxkdfy-fqmrbfjqsa-n
  • molecular-weight:
    • 534.867

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality