Difference between revisions of "SJ16746"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-36 CPD-36] == * common-name: ** 4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl-d-galacto...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14901 CPD-14901] == * common-name: ** poriferst-7-enol * smiles: ** ccc(c(c)c)ccc(c)[ch]3(c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-36 CPD-36] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14901 CPD-14901] ==
 
* common-name:
 
* common-name:
** 4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl-d-galactosamine
+
** poriferst-7-enol
 
* smiles:
 
* smiles:
** cc(=o)nc2(c(o)oc(co)c(o)c(oc1(oc(c([o-])=o)=cc(o)c(o)1))2)
+
** ccc(c(c)c)ccc(c)[ch]3(cc[ch]4(c2(=cc[ch]1(cc(o)ccc(c)1[ch]2ccc(c)34))))
 
* inchi-key:
 
* inchi-key:
** dlgjwsvwtwewbj-ztvljyeesa-m
+
** yskvbpgqyrauqo-xcfyoidpsa-n
 
* molecular-weight:
 
* molecular-weight:
** 378.312
+
** 414.713
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12178]]
+
* [[RXN-13892]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl-d-galactosamine}}
+
{{#set: common-name=poriferst-7-enol}}
{{#set: inchi-key=inchikey=dlgjwsvwtwewbj-ztvljyeesa-m}}
+
{{#set: inchi-key=inchikey=yskvbpgqyrauqo-xcfyoidpsa-n}}
{{#set: molecular-weight=378.312}}
+
{{#set: molecular-weight=414.713}}

Revision as of 14:20, 26 August 2019

Metabolite CPD-14901

  • common-name:
    • poriferst-7-enol
  • smiles:
    • ccc(c(c)c)ccc(c)[ch]3(cc[ch]4(c2(=cc[ch]1(cc(o)ccc(c)1[ch]2ccc(c)34))))
  • inchi-key:
    • yskvbpgqyrauqo-xcfyoidpsa-n
  • molecular-weight:
    • 414.713

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality