Difference between revisions of "SJ15971"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7496 CPD-7496] == * common-name: ** prolycopene * smiles: ** cc(=cccc(=cc=cc(c)=cc=cc(=cc=c...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=guanosine-34-tRNAs guanosine-34-tRNAs] == * common-name: ** a guanosine34 in trna == Reaction(s...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7496 CPD-7496] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=guanosine-34-tRNAs guanosine-34-tRNAs] ==
 
* common-name:
 
* common-name:
** prolycopene
+
** a guanosine34 in trna
* smiles:
 
** cc(=cccc(=cc=cc(c)=cc=cc(=cc=cc=c(c=cc=c(c)c=cc=c(ccc=c(c)c)c)c)c)c)c
 
* inchi-key:
 
** oaijszizwzsqbc-byunhuqqsa-n
 
* molecular-weight:
 
** 536.882
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8042]]
+
* [[RXN-11868]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11357]]
 
* [[RXN-12242]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=prolycopene}}
+
{{#set: common-name=a guanosine34 in trna}}
{{#set: inchi-key=inchikey=oaijszizwzsqbc-byunhuqqsa-n}}
 
{{#set: molecular-weight=536.882}}
 

Revision as of 14:20, 26 August 2019

Metabolite guanosine-34-tRNAs

  • common-name:
    • a guanosine34 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality