Difference between revisions of "PWY-6611"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15678 CPD-15678] == * common-name: ** 4-trans-3-oxo-undecenoyl-coa * smiles: ** ccccccc=cc(...")
(Created page with "Category:pathway == Pathway PWY-6313 == * taxonomic-range: ** tax-33208 * common-name: ** serotonin degradation == Reaction(s) found == * RXN-10777 * RXN-10778 * [...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15678 CPD-15678] ==
+
== Pathway PWY-6313 ==
 +
* taxonomic-range:
 +
** tax-33208
 
* common-name:
 
* common-name:
** 4-trans-3-oxo-undecenoyl-coa
+
** serotonin degradation
* smiles:
+
== Reaction(s) found ==
** ccccccc=cc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
* [[RXN-10777]]
* inchi-key:
+
* [[RXN-10778]]
** xbfqfvlnmjddng-dupkwvsksa-j
+
* [[RXN-10780]]
* molecular-weight:
+
* [[RXN-10781]]
** 943.749
+
* [[RXN-10782]]
== Reaction(s) known to consume the compound ==
+
* [[RXN-10784]]
* [[RXN-14793]]
+
== Reaction(s) not found ==
== Reaction(s) known to produce the compound ==
+
* [NoneRXN-10779 RXN-10779]
== Reaction(s) of unknown directionality ==
+
{{#set: taxonomic-range=tax-33208}}
{{#set: common-name=4-trans-3-oxo-undecenoyl-coa}}
+
{{#set: common-name=serotonin degradation}}
{{#set: inchi-key=inchikey=xbfqfvlnmjddng-dupkwvsksa-j}}
+
{{#set: nb reaction found=6}}
{{#set: molecular-weight=943.749}}
+
{{#set: completion rate=0.86}}
 +
{{#set: nb total reaction=7}}

Revision as of 20:15, 18 December 2020

Pathway PWY-6313

  • taxonomic-range:
    • tax-33208
  • common-name:
    • serotonin degradation

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-10779 RXN-10779]