Difference between revisions of "PWY-6372"

Revision as of 20:15, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7139 CPD-7139] ==
+== Pathway PWY-6368 ==
+* taxonomic-range:
+** tax-2759
 * common-name:
-** delphinidin 3,5-di-o-&beta;-d-glucoside
+** 3-phosphoinositide degradation
-* smiles:
+== Reaction(s) found ==
-** c(o)c1(c(o)c(o)c(o)c(o1)oc5(c4(c=c(oc2(c(o)c(o)c(o)c(co)o2))c(c3(c=c(o)c(o)=c(o)c=3))=[o+]c=4c=c([o-])c=5)))
+* [[3.1.3.66-RXN]]
-* inchi-key:
+* [[3.1.3.67-RXN]]
-** xctgxgvgjyacei-lcenjuansa-n
+* [[PHOSPHATIDYLINOSITOL-3-PHOSPHATASE-RXN]]
-* molecular-weight:
+* [[PHOSPHATIDYLINOSITOL-BISPHOSPHATASE-RXN]]
-** 626.524
+* [[RXN-10036]]
-== Reaction(s) known to consume the compound ==
+* [[RXN-10947]]
-== Reaction(s) known to produce the compound ==
+== Reaction(s) not found ==
-* [[RXN-8228]]
+* [NoneRXN-9779 RXN-9779]
-== Reaction(s) of unknown directionality ==
+* [NoneRXN-10961 RXN-10961]
-{{#set: common-name=delphinidin 3,5-di-o-&beta;-d-glucoside}}
+* [NoneRXN-10962 RXN-10962]
-{{#set: inchi-key=inchikey=xctgxgvgjyacei-lcenjuansa-n}}
+{{#set: taxonomic-range=tax-2759}}
-{{#set: molecular-weight=626.524}}
+{{#set: common-name=3-phosphoinositide degradation}}
+{{#set: nb reaction found=6}}
+{{#set: completion rate=0.67}}
+{{#set: nb total reaction=9}}