Difference between revisions of "PWY-5667"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-27 CPD66-27] == * common-name: ** pregn-5-ene-3,20-dione-17-ol * smiles: ** cc(=o)c4(o)(c...")
(Created page with "Category:pathway == Pathway PWY-5667 == * taxonomic-range: ** tax-2759 ** tax-2 * common-name: ** cdp-diacylglycerol biosynthesis i == Reaction(s) found == * CDPDIGLYSYN...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-27 CPD66-27] ==
+
== Pathway PWY-5667 ==
 +
* taxonomic-range:
 +
** tax-2759
 +
** tax-2
 
* common-name:
 
* common-name:
** pregn-5-ene-3,20-dione-17-ol
+
** cdp-diacylglycerol biosynthesis i
* smiles:
+
== Reaction(s) found ==
** cc(=o)c4(o)(ccc2(c(c)(ccc1(c3(c)(c(=ccc12)cc(=o)cc3)))4))
+
* [[CDPDIGLYSYN-RXN]]
* inchi-key:
+
* [[GLYC3PDEHYDROGBIOSYN-RXN]]
** rcfjdvcranozel-uhfffaoysa-n
+
* [[RXN-1381]]
* molecular-weight:
+
* [[RXN-1623]]
** 330.466
+
== Reaction(s) not found ==
== Reaction(s) known to consume the compound ==
+
All reactions of this pathways are in present
* [[RXN66-350]]
+
{{#set: taxonomic-range=tax-2|tax-2759}}
== Reaction(s) known to produce the compound ==
+
{{#set: common-name=cdp-diacylglycerol biosynthesis i}}
* [[RXN66-350]]
+
{{#set: nb reaction found=4}}
== Reaction(s) of unknown directionality ==
+
{{#set: completion rate=1.0}}
{{#set: common-name=pregn-5-ene-3,20-dione-17-ol}}
+
{{#set: nb total reaction=4}}
{{#set: inchi-key=inchikey=rcfjdvcranozel-uhfffaoysa-n}}
 
{{#set: molecular-weight=330.466}}
 

Revision as of 20:15, 18 December 2020

Pathway PWY-5667

  • taxonomic-range:
    • tax-2759
    • tax-2
  • common-name:
    • cdp-diacylglycerol biosynthesis i

Reaction(s) found

Reaction(s) not found

All reactions of this pathways are in present